C21H27N3O2 — CID 71792776
1-acetyl-N-[4-(3,4-dihydro-1H-isoquinolin-2-yl)but-2-ynyl]piperidine-4-carboxamide (PubChem CID 71792776) has the molecular formula C21H27N3O2 and a molecular weight of 353.47 g/mol. Its IUPAC name is 1-acetyl-N-[4-(3,4-dihydro-1H-isoquinolin-2-yl)but-2-ynyl]piperidine-4-carboxamide.
| Compound Name | 1-acetyl-N-[4-(3,4-dihydro-1H-isoquinolin-2-yl)but-2-ynyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 71792776 |
| Molecular Formula | C21H27N3O2 |
| Molecular Weight | 353.47 g/mol |
| Exact Mass | 353.21 |
| IUPAC Name | 1-acetyl-N-[4-(3,4-dihydro-1H-isoquinolin-2-yl)but-2-ynyl]piperidine-4-carboxamide |
| SMILES | CC(=O)N1CCC(C(=O)NCC#CCN2CCc3ccccc3C2)CC1 |
| InChI | InChI=1S/C21H27N3O2/c1-17(25)24-14-9-19(10-15-24)21(26)22-11-4-5-12-23-13-8-18-6-2-3-7-20(18)16-23/h2-3,6-7,19H,8-16H2,1H3,(H,22,26) |
| InChIKey | YNNQZFDEQWQVGR-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.47 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|