C21H24N2OS — CID 71792878
N-[4-[benzyl(methyl)amino]but-2-ynyl]-2-benzylsulfanylacetamide (PubChem CID 71792878) has the molecular formula C21H24N2OS and a molecular weight of 352.50 g/mol. Its IUPAC name is N-[4-[benzyl(methyl)amino]but-2-ynyl]-2-benzylsulfanylacetamide.
| Compound Name | N-[4-[benzyl(methyl)amino]but-2-ynyl]-2-benzylsulfanylacetamide |
|---|---|
| PubChem CID | 71792878 |
| Molecular Formula | C21H24N2OS |
| Molecular Weight | 352.50 g/mol |
| Exact Mass | 352.16 |
| IUPAC Name | N-[4-[benzyl(methyl)amino]but-2-ynyl]-2-benzylsulfanylacetamide |
| SMILES | CN(CC#CCNC(=O)CSCc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C21H24N2OS/c1-23(16-19-10-4-2-5-11-19)15-9-8-14-22-21(24)18-25-17-20-12-6-3-7-13-20/h2-7,10-13H,14-18H2,1H3,(H,22,24) |
| InChIKey | FEVPSXDMPQDTGH-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.50 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|