C12H8FN3S2 — CID 717973
4-(2-fluorophenyl)-7-methyl-[1,3]thiazolo[3,2-a][1,3,5]triazine-2-thione (PubChem CID 717973) has the molecular formula C12H8FN3S2 and a molecular weight of 277.35 g/mol. Its IUPAC name is 4-(2-fluorophenyl)-7-methyl-[1,3]thiazolo[3,2-a][1,3,5]triazine-2-thione.
| Compound Name | 4-(2-fluorophenyl)-7-methyl-[1,3]thiazolo[3,2-a][1,3,5]triazine-2-thione |
|---|---|
| PubChem CID | 717973 |
| Molecular Formula | C12H8FN3S2 |
| Molecular Weight | 277.35 g/mol |
| Exact Mass | 277.01 |
| IUPAC Name | 4-(2-fluorophenyl)-7-methyl-[1,3]thiazolo[3,2-a][1,3,5]triazine-2-thione |
| SMILES | Cc1cn2c(-c3ccccc3F)nc(=S)nc2s1 |
| InChI | InChI=1S/C12H8FN3S2/c1-7-6-16-10(8-4-2-3-5-9(8)13)14-11(17)15-12(16)18-7/h2-6H,1H3 |
| InChIKey | RLJDVMRURPRXCZ-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 30.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.35 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|