About 3-(4-methylsulfonylpiperazine-1-carbonyl)-1,4-thiazepan-5-one
3-(4-methylsulfonylpiperazine-1-carbonyl)-1,4-thiazepan-5-one (PubChem CID 71798089) has the molecular formula C11H19N3O4S2
and a molecular weight of 321.42 g/mol. Its IUPAC name is 3-(4-methylsulfonylpiperazine-1-carbonyl)-1,4-thiazepan-5-one.
Molecular Properties
| Compound Name | 3-(4-methylsulfonylpiperazine-1-carbonyl)-1,4-thiazepan-5-one |
| PubChem CID | 71798089 |
| Molecular Formula | C11H19N3O4S2 |
| Molecular Weight | 321.42 g/mol |
| Exact Mass | 321.08 |
| IUPAC Name | 3-(4-methylsulfonylpiperazine-1-carbonyl)-1,4-thiazepan-5-one |
| SMILES | CS(=O)(=O)N1CCN(C(=O)C2CSCCC(=O)N2)CC1 |
| InChI | InChI=1S/C11H19N3O4S2/c1-20(17,18)14-5-3-13(4-6-14)11(16)9-8-19-7-2-10(15)12-9/h9H,2-8H2,1H3,(H,12,15) |
| InChIKey | LPYIRIZVJTWLOU-UHFFFAOYSA-N |
| XLogP | -1.29 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 321.42 |
| LogP ≤ 5 | -1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-(4-methylsulfonylpiperazine-1-carbonyl)-1,4-thiazepan-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4-methylsulfonylpiperazine-1-carbonyl)-1,4-thiazepan-5-one?
The IUPAC name of 3-(4-methylsulfonylpiperazine-1-carbonyl)-1,4-thiazepan-5-one (CID 71798089) is 3-(4-methylsulfonylpiperazine-1-carbonyl)-1,4-thiazepan-5-one.
What is the SMILES notation for 3-(4-methylsulfonylpiperazine-1-carbonyl)-1,4-thiazepan-5-one?
The canonical SMILES for 3-(4-methylsulfonylpiperazine-1-carbonyl)-1,4-thiazepan-5-one is CS(=O)(=O)N1CCN(C(=O)C2CSCCC(=O)N2)CC1.
What is the InChIKey of 3-(4-methylsulfonylpiperazine-1-carbonyl)-1,4-thiazepan-5-one?
The InChIKey is LPYIRIZVJTWLOU-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19N3O4S2/c1-20(17,18)14-5-3-13(4-6-14)11(16)9-8-19-7-2-10(15)12-9/h9H,2-8H2,1H3,(H,12,15).
What are the key properties of 3-(4-methylsulfonylpiperazine-1-carbonyl)-1,4-thiazepan-5-one?
3-(4-methylsulfonylpiperazine-1-carbonyl)-1,4-thiazepan-5-one has a molecular weight of 321.42 g/mol, XLogP of -1.29, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-methylsulfonylpiperazine-1-carbonyl)-1,4-thiazepan-5-one is sourced from PubChem (CID 71798089), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).