C8H11F3N2O2S — CID 71798103
5-oxo-N-(2,2,2-trifluoroethyl)-1,4-thiazepane-3-carboxamide (PubChem CID 71798103) has the molecular formula C8H11F3N2O2S and a molecular weight of 256.25 g/mol. Its IUPAC name is 5-oxo-N-(2,2,2-trifluoroethyl)-1,4-thiazepane-3-carboxamide.
| Compound Name | 5-oxo-N-(2,2,2-trifluoroethyl)-1,4-thiazepane-3-carboxamide |
|---|---|
| PubChem CID | 71798103 |
| Molecular Formula | C8H11F3N2O2S |
| Molecular Weight | 256.25 g/mol |
| Exact Mass | 256.05 |
| IUPAC Name | 5-oxo-N-(2,2,2-trifluoroethyl)-1,4-thiazepane-3-carboxamide |
| SMILES | O=C1CCSCC(C(=O)NCC(F)(F)F)N1 |
| InChI | InChI=1S/C8H11F3N2O2S/c9-8(10,11)4-12-7(15)5-3-16-2-1-6(14)13-5/h5H,1-4H2,(H,12,15)(H,13,14) |
| InChIKey | YRQSCQQBQUCORN-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.25 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |