About (3S)-3-[2,6-dinitro-4-(trifluoromethyl)anilino]azepan-2-one
(3S)-3-[2,6-dinitro-4-(trifluoromethyl)anilino]azepan-2-one (PubChem CID 7179904) has the molecular formula C13H13F3N4O5
and a molecular weight of 362.26 g/mol. Its IUPAC name is (3S)-3-[2,6-dinitro-4-(trifluoromethyl)anilino]azepan-2-one.
Molecular Properties
| Compound Name | (3S)-3-[2,6-dinitro-4-(trifluoromethyl)anilino]azepan-2-one |
| PubChem CID | 7179904 |
| Molecular Formula | C13H13F3N4O5 |
| Molecular Weight | 362.26 g/mol |
| Exact Mass | 362.08 |
| IUPAC Name | (3S)-3-[2,6-dinitro-4-(trifluoromethyl)anilino]azepan-2-one |
| SMILES | O=C1NCCCC[C@@H]1Nc1c([N+](=O)[O-])cc(C(F)(F)F)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C13H13F3N4O5/c14-13(15,16)7-5-9(19(22)23)11(10(6-7)20(24)25)18-8-3-1-2-4-17-12(8)21/h5-6,8,18H,1-4H2,(H,17,21)/t8-/m0/s1 |
| InChIKey | HHYZNTQFJBNUSS-QMMMGPOBSA-N |
| XLogP | 2.60 |
| TPSA | 127.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 362.26 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (3S)-3-[2,6-dinitro-4-(trifluoromethyl)anilino]azepan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S)-3-[2,6-dinitro-4-(trifluoromethyl)anilino]azepan-2-one?
The IUPAC name of (3S)-3-[2,6-dinitro-4-(trifluoromethyl)anilino]azepan-2-one (CID 7179904) is (3S)-3-[2,6-dinitro-4-(trifluoromethyl)anilino]azepan-2-one.
What is the SMILES notation for (3S)-3-[2,6-dinitro-4-(trifluoromethyl)anilino]azepan-2-one?
The canonical SMILES for (3S)-3-[2,6-dinitro-4-(trifluoromethyl)anilino]azepan-2-one is O=C1NCCCC[C@@H]1Nc1c([N+](=O)[O-])cc(C(F)(F)F)cc1[N+](=O)[O-].
What is the InChIKey of (3S)-3-[2,6-dinitro-4-(trifluoromethyl)anilino]azepan-2-one?
The InChIKey is HHYZNTQFJBNUSS-QMMMGPOBSA-N. The full InChI is InChI=1S/C13H13F3N4O5/c14-13(15,16)7-5-9(19(22)23)11(10(6-7)20(24)25)18-8-3-1-2-4-17-12(8)21/h5-6,8,18H,1-4H2,(H,17,21)/t8-/m0/s1.
What are the key properties of (3S)-3-[2,6-dinitro-4-(trifluoromethyl)anilino]azepan-2-one?
(3S)-3-[2,6-dinitro-4-(trifluoromethyl)anilino]azepan-2-one has a molecular weight of 362.26 g/mol, XLogP of 2.60, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-3-[2,6-dinitro-4-(trifluoromethyl)anilino]azepan-2-one is sourced from PubChem (CID 7179904), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).