C19H19N5O2 — CID 71799334
(3-phenyl-1H-pyrazol-5-yl)-(4-pyridazin-3-yloxypiperidin-1-yl)methanone (PubChem CID 71799334) has the molecular formula C19H19N5O2 and a molecular weight of 349.39 g/mol. Its IUPAC name is (3-phenyl-1H-pyrazol-5-yl)-(4-pyridazin-3-yloxypiperidin-1-yl)methanone.
| Compound Name | (3-phenyl-1H-pyrazol-5-yl)-(4-pyridazin-3-yloxypiperidin-1-yl)methanone |
|---|---|
| PubChem CID | 71799334 |
| Molecular Formula | C19H19N5O2 |
| Molecular Weight | 349.39 g/mol |
| Exact Mass | 349.15 |
| IUPAC Name | (3-phenyl-1H-pyrazol-5-yl)-(4-pyridazin-3-yloxypiperidin-1-yl)methanone |
| SMILES | O=C(c1cc(-c2ccccc2)n[nH]1)N1CCC(Oc2cccnn2)CC1 |
| InChI | InChI=1S/C19H19N5O2/c25-19(17-13-16(21-22-17)14-5-2-1-3-6-14)24-11-8-15(9-12-24)26-18-7-4-10-20-23-18/h1-7,10,13,15H,8-9,11-12H2,(H,21,22) |
| InChIKey | OGGQYMSCROBDCU-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 84.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.39 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |