C19H18F3N5O — CID 71800001
N-[2-[(2-methyl-6-pyrrol-1-ylpyrimidin-4-yl)amino]ethyl]-3-(trifluoromethyl)benzamide (PubChem CID 71800001) has the molecular formula C19H18F3N5O and a molecular weight of 389.38 g/mol. Its IUPAC name is N-[2-[(2-methyl-6-pyrrol-1-ylpyrimidin-4-yl)amino]ethyl]-3-(trifluoromethyl)benzamide.
| Compound Name | N-[2-[(2-methyl-6-pyrrol-1-ylpyrimidin-4-yl)amino]ethyl]-3-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 71800001 |
| Molecular Formula | C19H18F3N5O |
| Molecular Weight | 389.38 g/mol |
| Exact Mass | 389.15 |
| IUPAC Name | N-[2-[(2-methyl-6-pyrrol-1-ylpyrimidin-4-yl)amino]ethyl]-3-(trifluoromethyl)benzamide |
| SMILES | Cc1nc(NCCNC(=O)c2cccc(C(F)(F)F)c2)cc(-n2cccc2)n1 |
| InChI | InChI=1S/C19H18F3N5O/c1-13-25-16(12-17(26-13)27-9-2-3-10-27)23-7-8-24-18(28)14-5-4-6-15(11-14)19(20,21)22/h2-6,9-12H,7-8H2,1H3,(H,24,28)(H,23,25,26) |
| InChIKey | NSIQOVOKUBYVAB-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 71.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.38 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|