About [1-(4,6-difluoro-1,3-benzothiazol-2-yl)azetidin-3-yl] quinoxaline-2-carboxylate
[1-(4,6-difluoro-1,3-benzothiazol-2-yl)azetidin-3-yl] quinoxaline-2-carboxylate (PubChem CID 71800400) has the molecular formula C19H12F2N4O2S
and a molecular weight of 398.39 g/mol. Its IUPAC name is [1-(4,6-difluoro-1,3-benzothiazol-2-yl)azetidin-3-yl] quinoxaline-2-carboxylate.
Molecular Properties
| Compound Name | [1-(4,6-difluoro-1,3-benzothiazol-2-yl)azetidin-3-yl] quinoxaline-2-carboxylate |
| PubChem CID | 71800400 |
| Molecular Formula | C19H12F2N4O2S |
| Molecular Weight | 398.39 g/mol |
| Exact Mass | 398.06 |
| IUPAC Name | [1-(4,6-difluoro-1,3-benzothiazol-2-yl)azetidin-3-yl] quinoxaline-2-carboxylate |
| SMILES | O=C(OC1CN(c2nc3c(F)cc(F)cc3s2)C1)c1cnc2ccccc2n1 |
| InChI | InChI=1S/C19H12F2N4O2S/c20-10-5-12(21)17-16(6-10)28-19(24-17)25-8-11(9-25)27-18(26)15-7-22-13-3-1-2-4-14(13)23-15/h1-7,11H,8-9H2 |
| InChIKey | OCHUWLBNDNDTGW-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 68.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 398.39 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze [1-(4,6-difluoro-1,3-benzothiazol-2-yl)azetidin-3-yl] quinoxaline-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-(4,6-difluoro-1,3-benzothiazol-2-yl)azetidin-3-yl] quinoxaline-2-carboxylate?
The IUPAC name of [1-(4,6-difluoro-1,3-benzothiazol-2-yl)azetidin-3-yl] quinoxaline-2-carboxylate (CID 71800400) is [1-(4,6-difluoro-1,3-benzothiazol-2-yl)azetidin-3-yl] quinoxaline-2-carboxylate.
What is the SMILES notation for [1-(4,6-difluoro-1,3-benzothiazol-2-yl)azetidin-3-yl] quinoxaline-2-carboxylate?
The canonical SMILES for [1-(4,6-difluoro-1,3-benzothiazol-2-yl)azetidin-3-yl] quinoxaline-2-carboxylate is O=C(OC1CN(c2nc3c(F)cc(F)cc3s2)C1)c1cnc2ccccc2n1.
What is the InChIKey of [1-(4,6-difluoro-1,3-benzothiazol-2-yl)azetidin-3-yl] quinoxaline-2-carboxylate?
The InChIKey is OCHUWLBNDNDTGW-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H12F2N4O2S/c20-10-5-12(21)17-16(6-10)28-19(24-17)25-8-11(9-25)27-18(26)15-7-22-13-3-1-2-4-14(13)23-15/h1-7,11H,8-9H2.
What are the key properties of [1-(4,6-difluoro-1,3-benzothiazol-2-yl)azetidin-3-yl] quinoxaline-2-carboxylate?
[1-(4,6-difluoro-1,3-benzothiazol-2-yl)azetidin-3-yl] quinoxaline-2-carboxylate has a molecular weight of 398.39 g/mol, XLogP of 3.56, 3 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [1-(4,6-difluoro-1,3-benzothiazol-2-yl)azetidin-3-yl] quinoxaline-2-carboxylate is sourced from PubChem (CID 71800400), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).