C23H18N4O3 — CID 7180072
N-(3-cyanophenyl)-2-[(4R)-4-methyl-4-naphthalen-1-yl-2,5-dioxoimidazolidin-1-yl]acetamide (PubChem CID 7180072) has the molecular formula C23H18N4O3 and a molecular weight of 398.42 g/mol. Its IUPAC name is N-(3-cyanophenyl)-2-[(4R)-4-methyl-4-naphthalen-1-yl-2,5-dioxoimidazolidin-1-yl]acetamide.
| Compound Name | N-(3-cyanophenyl)-2-[(4R)-4-methyl-4-naphthalen-1-yl-2,5-dioxoimidazolidin-1-yl]acetamide |
|---|---|
| PubChem CID | 7180072 |
| Molecular Formula | C23H18N4O3 |
| Molecular Weight | 398.42 g/mol |
| Exact Mass | 398.14 |
| IUPAC Name | N-(3-cyanophenyl)-2-[(4R)-4-methyl-4-naphthalen-1-yl-2,5-dioxoimidazolidin-1-yl]acetamide |
| SMILES | C[C@]1(c2cccc3ccccc23)NC(=O)N(CC(=O)Nc2cccc(C#N)c2)C1=O |
| InChI | InChI=1S/C23H18N4O3/c1-23(19-11-5-8-16-7-2-3-10-18(16)19)21(29)27(22(30)26-23)14-20(28)25-17-9-4-6-15(12-17)13-24/h2-12H,14H2,1H3,(H,25,28)(H,26,30)/t23-/m1/s1 |
| InChIKey | WCYSUPKVUPKOLI-HSZRJFAPSA-N |
| XLogP | 3.12 |
| TPSA | 102.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.42 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|