C16H20BrN3O2S2 — CID 71800894
1-(4-bromophenyl)sulfonyl-4-[(1-methylimidazol-2-yl)sulfanylmethyl]piperidine (PubChem CID 71800894) has the molecular formula C16H20BrN3O2S2 and a molecular weight of 430.39 g/mol. Its IUPAC name is 1-(4-bromophenyl)sulfonyl-4-[(1-methylimidazol-2-yl)sulfanylmethyl]piperidine.
| Compound Name | 1-(4-bromophenyl)sulfonyl-4-[(1-methylimidazol-2-yl)sulfanylmethyl]piperidine |
|---|---|
| PubChem CID | 71800894 |
| Molecular Formula | C16H20BrN3O2S2 |
| Molecular Weight | 430.39 g/mol |
| Exact Mass | 429.02 |
| IUPAC Name | 1-(4-bromophenyl)sulfonyl-4-[(1-methylimidazol-2-yl)sulfanylmethyl]piperidine |
| SMILES | Cn1ccnc1SCC1CCN(S(=O)(=O)c2ccc(Br)cc2)CC1 |
| InChI | InChI=1S/C16H20BrN3O2S2/c1-19-11-8-18-16(19)23-12-13-6-9-20(10-7-13)24(21,22)15-4-2-14(17)3-5-15/h2-5,8,11,13H,6-7,9-10,12H2,1H3 |
| InChIKey | FXBZYLRWVSNZMK-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 55.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.39 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |