C12H23N3O — CID 71801371
N-ethyl-9-methyl-6,9-diazaspiro[4.5]decane-6-carboxamide (PubChem CID 71801371) has the molecular formula C12H23N3O and a molecular weight of 225.34 g/mol. Its IUPAC name is N-ethyl-9-methyl-6,9-diazaspiro[4.5]decane-6-carboxamide.
| Compound Name | N-ethyl-9-methyl-6,9-diazaspiro[4.5]decane-6-carboxamide |
|---|---|
| PubChem CID | 71801371 |
| Molecular Formula | C12H23N3O |
| Molecular Weight | 225.34 g/mol |
| Exact Mass | 225.18 |
| IUPAC Name | N-ethyl-9-methyl-6,9-diazaspiro[4.5]decane-6-carboxamide |
| SMILES | CCNC(=O)N1CCN(C)CC12CCCC2 |
| InChI | InChI=1S/C12H23N3O/c1-3-13-11(16)15-9-8-14(2)10-12(15)6-4-5-7-12/h3-10H2,1-2H3,(H,13,16) |
| InChIKey | VBABQOBMKKUCCY-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.34 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |