C18H15ClN2O4 — CID 7180504
(5R)-3-(1,3-benzodioxol-5-ylmethyl)-5-(2-chlorophenyl)-5-methylimidazolidine-2,4-dione (PubChem CID 7180504) has the molecular formula C18H15ClN2O4 and a molecular weight of 358.78 g/mol. Its IUPAC name is (5R)-3-(1,3-benzodioxol-5-ylmethyl)-5-(2-chlorophenyl)-5-methylimidazolidine-2,4-dione.
| Compound Name | (5R)-3-(1,3-benzodioxol-5-ylmethyl)-5-(2-chlorophenyl)-5-methylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 7180504 |
| Molecular Formula | C18H15ClN2O4 |
| Molecular Weight | 358.78 g/mol |
| Exact Mass | 358.07 |
| IUPAC Name | (5R)-3-(1,3-benzodioxol-5-ylmethyl)-5-(2-chlorophenyl)-5-methylimidazolidine-2,4-dione |
| SMILES | C[C@]1(c2ccccc2Cl)NC(=O)N(Cc2ccc3c(c2)OCO3)C1=O |
| InChI | InChI=1S/C18H15ClN2O4/c1-18(12-4-2-3-5-13(12)19)16(22)21(17(23)20-18)9-11-6-7-14-15(8-11)25-10-24-14/h2-8H,9-10H2,1H3,(H,20,23)/t18-/m1/s1 |
| InChIKey | XPEYLRUXJLUTQP-GOSISDBHSA-N |
| XLogP | 3.04 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.78 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|