About N-[2-[6-oxo-3-(1,2,4-triazol-1-yl)pyridazin-1-yl]ethyl]thiophene-3-carboxamide
N-[2-[6-oxo-3-(1,2,4-triazol-1-yl)pyridazin-1-yl]ethyl]thiophene-3-carboxamide (PubChem CID 71805261) has the molecular formula C13H12N6O2S
and a molecular weight of 316.35 g/mol. Its IUPAC name is N-[2-[6-oxo-3-(1,2,4-triazol-1-yl)pyridazin-1-yl]ethyl]thiophene-3-carboxamide.
Molecular Properties
| Compound Name | N-[2-[6-oxo-3-(1,2,4-triazol-1-yl)pyridazin-1-yl]ethyl]thiophene-3-carboxamide |
| PubChem CID | 71805261 |
| Molecular Formula | C13H12N6O2S |
| Molecular Weight | 316.35 g/mol |
| Exact Mass | 316.07 |
| IUPAC Name | N-[2-[6-oxo-3-(1,2,4-triazol-1-yl)pyridazin-1-yl]ethyl]thiophene-3-carboxamide |
| SMILES | O=C(NCCn1nc(-n2cncn2)ccc1=O)c1ccsc1 |
| InChI | InChI=1S/C13H12N6O2S/c20-12-2-1-11(19-9-14-8-16-19)17-18(12)5-4-15-13(21)10-3-6-22-7-10/h1-3,6-9H,4-5H2,(H,15,21) |
| InChIKey | KGPJQGQEBVIEAL-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 94.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 316.35 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze N-[2-[6-oxo-3-(1,2,4-triazol-1-yl)pyridazin-1-yl]ethyl]thiophene-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-[6-oxo-3-(1,2,4-triazol-1-yl)pyridazin-1-yl]ethyl]thiophene-3-carboxamide?
The IUPAC name of N-[2-[6-oxo-3-(1,2,4-triazol-1-yl)pyridazin-1-yl]ethyl]thiophene-3-carboxamide (CID 71805261) is N-[2-[6-oxo-3-(1,2,4-triazol-1-yl)pyridazin-1-yl]ethyl]thiophene-3-carboxamide.
What is the SMILES notation for N-[2-[6-oxo-3-(1,2,4-triazol-1-yl)pyridazin-1-yl]ethyl]thiophene-3-carboxamide?
The canonical SMILES for N-[2-[6-oxo-3-(1,2,4-triazol-1-yl)pyridazin-1-yl]ethyl]thiophene-3-carboxamide is O=C(NCCn1nc(-n2cncn2)ccc1=O)c1ccsc1.
What is the InChIKey of N-[2-[6-oxo-3-(1,2,4-triazol-1-yl)pyridazin-1-yl]ethyl]thiophene-3-carboxamide?
The InChIKey is KGPJQGQEBVIEAL-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12N6O2S/c20-12-2-1-11(19-9-14-8-16-19)17-18(12)5-4-15-13(21)10-3-6-22-7-10/h1-3,6-9H,4-5H2,(H,15,21).
What are the key properties of N-[2-[6-oxo-3-(1,2,4-triazol-1-yl)pyridazin-1-yl]ethyl]thiophene-3-carboxamide?
N-[2-[6-oxo-3-(1,2,4-triazol-1-yl)pyridazin-1-yl]ethyl]thiophene-3-carboxamide has a molecular weight of 316.35 g/mol, XLogP of 0.32, 5 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-[6-oxo-3-(1,2,4-triazol-1-yl)pyridazin-1-yl]ethyl]thiophene-3-carboxamide is sourced from PubChem (CID 71805261), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).