C18H18ClNO3S2 — CID 71808946
[3-(benzenesulfonyl)-8-azabicyclo[3.2.1]octan-8-yl]-(5-chlorothiophen-2-yl)methanone (PubChem CID 71808946) has the molecular formula C18H18ClNO3S2 and a molecular weight of 395.93 g/mol. Its IUPAC name is [3-(benzenesulfonyl)-8-azabicyclo[3.2.1]octan-8-yl]-(5-chlorothiophen-2-yl)methanone.
| Compound Name | [3-(benzenesulfonyl)-8-azabicyclo[3.2.1]octan-8-yl]-(5-chlorothiophen-2-yl)methanone |
|---|---|
| PubChem CID | 71808946 |
| Molecular Formula | C18H18ClNO3S2 |
| Molecular Weight | 395.93 g/mol |
| Exact Mass | 395.04 |
| IUPAC Name | [3-(benzenesulfonyl)-8-azabicyclo[3.2.1]octan-8-yl]-(5-chlorothiophen-2-yl)methanone |
| SMILES | O=C(c1ccc(Cl)s1)N1C2CCC1CC(S(=O)(=O)c1ccccc1)C2 |
| InChI | InChI=1S/C18H18ClNO3S2/c19-17-9-8-16(24-17)18(21)20-12-6-7-13(20)11-15(10-12)25(22,23)14-4-2-1-3-5-14/h1-5,8-9,12-13,15H,6-7,10-11H2 |
| InChIKey | FPLOQDGHQIWQPZ-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.93 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |