About 3-cyclohexylsulfonyl-N,N-dimethylazetidine-1-sulfonamide
3-cyclohexylsulfonyl-N,N-dimethylazetidine-1-sulfonamide (PubChem CID 71809374) has the molecular formula C11H22N2O4S2
and a molecular weight of 310.44 g/mol. Its IUPAC name is 3-cyclohexylsulfonyl-N,N-dimethylazetidine-1-sulfonamide.
Molecular Properties
| Compound Name | 3-cyclohexylsulfonyl-N,N-dimethylazetidine-1-sulfonamide |
| PubChem CID | 71809374 |
| Molecular Formula | C11H22N2O4S2 |
| Molecular Weight | 310.44 g/mol |
| Exact Mass | 310.10 |
| IUPAC Name | 3-cyclohexylsulfonyl-N,N-dimethylazetidine-1-sulfonamide |
| SMILES | CN(C)S(=O)(=O)N1CC(S(=O)(=O)C2CCCCC2)C1 |
| InChI | InChI=1S/C11H22N2O4S2/c1-12(2)19(16,17)13-8-11(9-13)18(14,15)10-6-4-3-5-7-10/h10-11H,3-9H2,1-2H3 |
| InChIKey | SEHMEEIEVGTRCI-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.44 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-cyclohexylsulfonyl-N,N-dimethylazetidine-1-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-cyclohexylsulfonyl-N,N-dimethylazetidine-1-sulfonamide?
The IUPAC name of 3-cyclohexylsulfonyl-N,N-dimethylazetidine-1-sulfonamide (CID 71809374) is 3-cyclohexylsulfonyl-N,N-dimethylazetidine-1-sulfonamide.
What is the SMILES notation for 3-cyclohexylsulfonyl-N,N-dimethylazetidine-1-sulfonamide?
The canonical SMILES for 3-cyclohexylsulfonyl-N,N-dimethylazetidine-1-sulfonamide is CN(C)S(=O)(=O)N1CC(S(=O)(=O)C2CCCCC2)C1.
What is the InChIKey of 3-cyclohexylsulfonyl-N,N-dimethylazetidine-1-sulfonamide?
The InChIKey is SEHMEEIEVGTRCI-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H22N2O4S2/c1-12(2)19(16,17)13-8-11(9-13)18(14,15)10-6-4-3-5-7-10/h10-11H,3-9H2,1-2H3.
What are the key properties of 3-cyclohexylsulfonyl-N,N-dimethylazetidine-1-sulfonamide?
3-cyclohexylsulfonyl-N,N-dimethylazetidine-1-sulfonamide has a molecular weight of 310.44 g/mol, XLogP of 0.22, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-cyclohexylsulfonyl-N,N-dimethylazetidine-1-sulfonamide is sourced from PubChem (CID 71809374), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).