C15H15NO4S2 — CID 71809390
(E)-1-[3-(furan-2-ylmethylsulfonyl)azetidin-1-yl]-3-thiophen-2-ylprop-2-en-1-one (PubChem CID 71809390) has the molecular formula C15H15NO4S2 and a molecular weight of 337.42 g/mol. Its IUPAC name is (E)-1-[3-(furan-2-ylmethylsulfonyl)azetidin-1-yl]-3-thiophen-2-ylprop-2-en-1-one.
| Compound Name | (E)-1-[3-(furan-2-ylmethylsulfonyl)azetidin-1-yl]-3-thiophen-2-ylprop-2-en-1-one |
|---|---|
| PubChem CID | 71809390 |
| Molecular Formula | C15H15NO4S2 |
| Molecular Weight | 337.42 g/mol |
| Exact Mass | 337.04 |
| IUPAC Name | (E)-1-[3-(furan-2-ylmethylsulfonyl)azetidin-1-yl]-3-thiophen-2-ylprop-2-en-1-one |
| SMILES | O=C(/C=C/c1cccs1)N1CC(S(=O)(=O)Cc2ccco2)C1 |
| InChI | InChI=1S/C15H15NO4S2/c17-15(6-5-13-4-2-8-21-13)16-9-14(10-16)22(18,19)11-12-3-1-7-20-12/h1-8,14H,9-11H2/b6-5+ |
| InChIKey | AUQCFGGOYFSUBC-AATRIKPKSA-N |
| XLogP | 2.18 |
| TPSA | 67.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.42 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|