C14H24N4O4 — CID 7181006
N-(tert-butylcarbamoyl)-2-(4,4-diethyl-2,5-dioxoimidazolidin-1-yl)acetamide (PubChem CID 7181006) has the molecular formula C14H24N4O4 and a molecular weight of 312.37 g/mol. Its IUPAC name is N-(tert-butylcarbamoyl)-2-(4,4-diethyl-2,5-dioxoimidazolidin-1-yl)acetamide.
| Compound Name | N-(tert-butylcarbamoyl)-2-(4,4-diethyl-2,5-dioxoimidazolidin-1-yl)acetamide |
|---|---|
| PubChem CID | 7181006 |
| Molecular Formula | C14H24N4O4 |
| Molecular Weight | 312.37 g/mol |
| Exact Mass | 312.18 |
| IUPAC Name | N-(tert-butylcarbamoyl)-2-(4,4-diethyl-2,5-dioxoimidazolidin-1-yl)acetamide |
| SMILES | CCC1(CC)NC(=O)N(CC(=O)NC(=O)NC(C)(C)C)C1=O |
| InChI | InChI=1S/C14H24N4O4/c1-6-14(7-2)10(20)18(12(22)17-14)8-9(19)15-11(21)16-13(3,4)5/h6-8H2,1-5H3,(H,17,22)(H2,15,16,19,21) |
| InChIKey | FDMHMAKWRIMEDB-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 107.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.37 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|