About N-carbamoyl-2-(4,4-diethyl-2,5-dioxoimidazolidin-1-yl)acetamide
N-carbamoyl-2-(4,4-diethyl-2,5-dioxoimidazolidin-1-yl)acetamide (PubChem CID 7181056) has the molecular formula C10H16N4O4
and a molecular weight of 256.26 g/mol. Its IUPAC name is N-carbamoyl-2-(4,4-diethyl-2,5-dioxoimidazolidin-1-yl)acetamide.
Molecular Properties
| Compound Name | N-carbamoyl-2-(4,4-diethyl-2,5-dioxoimidazolidin-1-yl)acetamide |
| PubChem CID | 7181056 |
| Molecular Formula | C10H16N4O4 |
| Molecular Weight | 256.26 g/mol |
| Exact Mass | 256.12 |
| IUPAC Name | N-carbamoyl-2-(4,4-diethyl-2,5-dioxoimidazolidin-1-yl)acetamide |
| SMILES | CCC1(CC)NC(=O)N(CC(=O)NC(N)=O)C1=O |
| InChI | InChI=1S/C10H16N4O4/c1-3-10(4-2)7(16)14(9(18)13-10)5-6(15)12-8(11)17/h3-5H2,1-2H3,(H,13,18)(H3,11,12,15,17) |
| InChIKey | HXXYMLGHRUEZHS-UHFFFAOYSA-N |
| XLogP | -0.71 |
| TPSA | 121.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.26 |
| LogP ≤ 5 | -0.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|
Analyze N-carbamoyl-2-(4,4-diethyl-2,5-dioxoimidazolidin-1-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-carbamoyl-2-(4,4-diethyl-2,5-dioxoimidazolidin-1-yl)acetamide?
The IUPAC name of N-carbamoyl-2-(4,4-diethyl-2,5-dioxoimidazolidin-1-yl)acetamide (CID 7181056) is N-carbamoyl-2-(4,4-diethyl-2,5-dioxoimidazolidin-1-yl)acetamide.
What is the SMILES notation for N-carbamoyl-2-(4,4-diethyl-2,5-dioxoimidazolidin-1-yl)acetamide?
The canonical SMILES for N-carbamoyl-2-(4,4-diethyl-2,5-dioxoimidazolidin-1-yl)acetamide is CCC1(CC)NC(=O)N(CC(=O)NC(N)=O)C1=O.
What is the InChIKey of N-carbamoyl-2-(4,4-diethyl-2,5-dioxoimidazolidin-1-yl)acetamide?
The InChIKey is HXXYMLGHRUEZHS-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16N4O4/c1-3-10(4-2)7(16)14(9(18)13-10)5-6(15)12-8(11)17/h3-5H2,1-2H3,(H,13,18)(H3,11,12,15,17).
What are the key properties of N-carbamoyl-2-(4,4-diethyl-2,5-dioxoimidazolidin-1-yl)acetamide?
N-carbamoyl-2-(4,4-diethyl-2,5-dioxoimidazolidin-1-yl)acetamide has a molecular weight of 256.26 g/mol, XLogP of -0.71, 4 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-carbamoyl-2-(4,4-diethyl-2,5-dioxoimidazolidin-1-yl)acetamide is sourced from PubChem (CID 7181056), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).