About N-[(4-ethoxy-1,3-dimethyl-2,6-dioxopyrimidin-5-yl)methylidene]acetamide
N-[(4-ethoxy-1,3-dimethyl-2,6-dioxopyrimidin-5-yl)methylidene]acetamide (PubChem CID 71811194) has the molecular formula C11H15N3O4
and a molecular weight of 253.26 g/mol. Its IUPAC name is N-[(4-ethoxy-1,3-dimethyl-2,6-dioxopyrimidin-5-yl)methylidene]acetamide.
Molecular Properties
| Compound Name | N-[(4-ethoxy-1,3-dimethyl-2,6-dioxopyrimidin-5-yl)methylidene]acetamide |
| PubChem CID | 71811194 |
| Molecular Formula | C11H15N3O4 |
| Molecular Weight | 253.26 g/mol |
| Exact Mass | 253.11 |
| IUPAC Name | N-[(4-ethoxy-1,3-dimethyl-2,6-dioxopyrimidin-5-yl)methylidene]acetamide |
| SMILES | CCOc1c(/C=N/C(C)=O)c(=O)n(C)c(=O)n1C |
| InChI | InChI=1S/C11H15N3O4/c1-5-18-10-8(6-12-7(2)15)9(16)13(3)11(17)14(10)4/h6H,5H2,1-4H3/b12-6+ |
| InChIKey | QWONQMGMTIKOOE-WUXMJOGZSA-N |
| XLogP | -0.55 |
| TPSA | 82.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.26 |
| LogP ≤ 5 | -0.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze N-[(4-ethoxy-1,3-dimethyl-2,6-dioxopyrimidin-5-yl)methylidene]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(4-ethoxy-1,3-dimethyl-2,6-dioxopyrimidin-5-yl)methylidene]acetamide?
The IUPAC name of N-[(4-ethoxy-1,3-dimethyl-2,6-dioxopyrimidin-5-yl)methylidene]acetamide (CID 71811194) is N-[(4-ethoxy-1,3-dimethyl-2,6-dioxopyrimidin-5-yl)methylidene]acetamide.
What is the SMILES notation for N-[(4-ethoxy-1,3-dimethyl-2,6-dioxopyrimidin-5-yl)methylidene]acetamide?
The canonical SMILES for N-[(4-ethoxy-1,3-dimethyl-2,6-dioxopyrimidin-5-yl)methylidene]acetamide is CCOc1c(/C=N/C(C)=O)c(=O)n(C)c(=O)n1C.
What is the InChIKey of N-[(4-ethoxy-1,3-dimethyl-2,6-dioxopyrimidin-5-yl)methylidene]acetamide?
The InChIKey is QWONQMGMTIKOOE-WUXMJOGZSA-N. The full InChI is InChI=1S/C11H15N3O4/c1-5-18-10-8(6-12-7(2)15)9(16)13(3)11(17)14(10)4/h6H,5H2,1-4H3/b12-6+.
What are the key properties of N-[(4-ethoxy-1,3-dimethyl-2,6-dioxopyrimidin-5-yl)methylidene]acetamide?
N-[(4-ethoxy-1,3-dimethyl-2,6-dioxopyrimidin-5-yl)methylidene]acetamide has a molecular weight of 253.26 g/mol, XLogP of -0.55, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(4-ethoxy-1,3-dimethyl-2,6-dioxopyrimidin-5-yl)methylidene]acetamide is sourced from PubChem (CID 71811194), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).