C11H14F3N3O2S — CID 71811244
(E)-3,3,3-trifluoro-N-[2-[(4-methyl-2-pyridinyl)amino]ethyl]prop-1-ene-1-sulfonamide (PubChem CID 71811244) has the molecular formula C11H14F3N3O2S and a molecular weight of 309.31 g/mol. Its IUPAC name is (E)-3,3,3-trifluoro-N-[2-[(4-methyl-2-pyridinyl)amino]ethyl]prop-1-ene-1-sulfonamide.
| Compound Name | (E)-3,3,3-trifluoro-N-[2-[(4-methyl-2-pyridinyl)amino]ethyl]prop-1-ene-1-sulfonamide |
|---|---|
| PubChem CID | 71811244 |
| Molecular Formula | C11H14F3N3O2S |
| Molecular Weight | 309.31 g/mol |
| Exact Mass | 309.08 |
| IUPAC Name | (E)-3,3,3-trifluoro-N-[2-[(4-methyl-2-pyridinyl)amino]ethyl]prop-1-ene-1-sulfonamide |
| SMILES | Cc1ccnc(NCCNS(=O)(=O)/C=C/C(F)(F)F)c1 |
| InChI | InChI=1S/C11H14F3N3O2S/c1-9-2-4-15-10(8-9)16-5-6-17-20(18,19)7-3-11(12,13)14/h2-4,7-8,17H,5-6H2,1H3,(H,15,16)/b7-3+ |
| InChIKey | VAEBTEQNSCPUPJ-XVNBXDOJSA-N |
| XLogP | 1.80 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.31 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|