C24H17F7O — CID 71811659
5-[4-[difluoro-(3,4,5-trifluorophenoxy)methyl]-3,5-difluorophenyl]-2-ethyl-2,3-dihydro-1H-indene (PubChem CID 71811659) has the molecular formula C24H17F7O and a molecular weight of 454.39 g/mol. Its IUPAC name is 5-[4-[difluoro-(3,4,5-trifluorophenoxy)methyl]-3,5-difluorophenyl]-2-ethyl-2,3-dihydro-1H-indene.
| Compound Name | 5-[4-[difluoro-(3,4,5-trifluorophenoxy)methyl]-3,5-difluorophenyl]-2-ethyl-2,3-dihydro-1H-indene |
|---|---|
| PubChem CID | 71811659 |
| Molecular Formula | C24H17F7O |
| Molecular Weight | 454.39 g/mol |
| Exact Mass | 454.12 |
| IUPAC Name | 5-[4-[difluoro-(3,4,5-trifluorophenoxy)methyl]-3,5-difluorophenyl]-2-ethyl-2,3-dihydro-1H-indene |
| SMILES | CCC1Cc2ccc(-c3cc(F)c(C(F)(F)Oc4cc(F)c(F)c(F)c4)c(F)c3)cc2C1 |
| InChI | InChI=1S/C24H17F7O/c1-2-12-5-13-3-4-14(7-15(13)6-12)16-8-18(25)22(19(26)9-16)24(30,31)32-17-10-20(27)23(29)21(28)11-17/h3-4,7-12H,2,5-6H2,1H3 |
| InChIKey | UWNXZUMHJWJXQQ-UHFFFAOYSA-N |
| XLogP | 7.30 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.39 |
| LogP ≤ 5 | 7.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|