C13H16F3N3O2 — CID 71811866
(E)-4,4,4-trifluoro-N-[2-[(6-methoxy-2-methyl-3-pyridinyl)amino]ethyl]but-2-enamide (PubChem CID 71811866) has the molecular formula C13H16F3N3O2 and a molecular weight of 303.28 g/mol. Its IUPAC name is (E)-4,4,4-trifluoro-N-[2-[(6-methoxy-2-methyl-3-pyridinyl)amino]ethyl]but-2-enamide.
| Compound Name | (E)-4,4,4-trifluoro-N-[2-[(6-methoxy-2-methyl-3-pyridinyl)amino]ethyl]but-2-enamide |
|---|---|
| PubChem CID | 71811866 |
| Molecular Formula | C13H16F3N3O2 |
| Molecular Weight | 303.28 g/mol |
| Exact Mass | 303.12 |
| IUPAC Name | (E)-4,4,4-trifluoro-N-[2-[(6-methoxy-2-methyl-3-pyridinyl)amino]ethyl]but-2-enamide |
| SMILES | COc1ccc(NCCNC(=O)/C=C/C(F)(F)F)c(C)n1 |
| InChI | InChI=1S/C13H16F3N3O2/c1-9-10(3-4-12(19-9)21-2)17-7-8-18-11(20)5-6-13(14,15)16/h3-6,17H,7-8H2,1-2H3,(H,18,20)/b6-5+ |
| InChIKey | LAJWJEYHECXDFB-AATRIKPKSA-N |
| XLogP | 2.05 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.28 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|