C19H17F5N2O — CID 71811939
N-[1-[[4-(1,1,2,2,2-pentafluoroethyl)phenyl]methyl]-2,3-dihydroindol-5-yl]acetamide (PubChem CID 71811939) has the molecular formula C19H17F5N2O and a molecular weight of 384.35 g/mol. Its IUPAC name is N-[1-[[4-(1,1,2,2,2-pentafluoroethyl)phenyl]methyl]-2,3-dihydroindol-5-yl]acetamide.
| Compound Name | N-[1-[[4-(1,1,2,2,2-pentafluoroethyl)phenyl]methyl]-2,3-dihydroindol-5-yl]acetamide |
|---|---|
| PubChem CID | 71811939 |
| Molecular Formula | C19H17F5N2O |
| Molecular Weight | 384.35 g/mol |
| Exact Mass | 384.13 |
| IUPAC Name | N-[1-[[4-(1,1,2,2,2-pentafluoroethyl)phenyl]methyl]-2,3-dihydroindol-5-yl]acetamide |
| SMILES | CC(=O)Nc1ccc2c(c1)CCN2Cc1ccc(C(F)(F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C19H17F5N2O/c1-12(27)25-16-6-7-17-14(10-16)8-9-26(17)11-13-2-4-15(5-3-13)18(20,21)19(22,23)24/h2-7,10H,8-9,11H2,1H3,(H,25,27) |
| InChIKey | SCYDXDFRDIQABR-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.35 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|