C15H16N2O3S — CID 71811954
4-(3-methyl-4-oxo-2,5,6,7-tetrahydroisoindol-1-yl)benzenesulfonamide (PubChem CID 71811954) has the molecular formula C15H16N2O3S and a molecular weight of 304.37 g/mol. Its IUPAC name is 4-(3-methyl-4-oxo-2,5,6,7-tetrahydroisoindol-1-yl)benzenesulfonamide.
| Compound Name | 4-(3-methyl-4-oxo-2,5,6,7-tetrahydroisoindol-1-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 71811954 |
| Molecular Formula | C15H16N2O3S |
| Molecular Weight | 304.37 g/mol |
| Exact Mass | 304.09 |
| IUPAC Name | 4-(3-methyl-4-oxo-2,5,6,7-tetrahydroisoindol-1-yl)benzenesulfonamide |
| SMILES | Cc1[nH]c(-c2ccc(S(N)(=O)=O)cc2)c2c1C(=O)CCC2 |
| InChI | InChI=1S/C15H16N2O3S/c1-9-14-12(3-2-4-13(14)18)15(17-9)10-5-7-11(8-6-10)21(16,19)20/h5-8,17H,2-4H2,1H3,(H2,16,19,20) |
| InChIKey | BGLDFYUDXWBVGT-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 93.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.37 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |