C21H19NO2 — CID 71811973
3-methyl-1-(2-phenoxyphenyl)-2,5,6,7-tetrahydroisoindol-4-one (PubChem CID 71811973) has the molecular formula C21H19NO2 and a molecular weight of 317.39 g/mol. Its IUPAC name is 3-methyl-1-(2-phenoxyphenyl)-2,5,6,7-tetrahydroisoindol-4-one.
| Compound Name | 3-methyl-1-(2-phenoxyphenyl)-2,5,6,7-tetrahydroisoindol-4-one |
|---|---|
| PubChem CID | 71811973 |
| Molecular Formula | C21H19NO2 |
| Molecular Weight | 317.39 g/mol |
| Exact Mass | 317.14 |
| IUPAC Name | 3-methyl-1-(2-phenoxyphenyl)-2,5,6,7-tetrahydroisoindol-4-one |
| SMILES | Cc1[nH]c(-c2ccccc2Oc2ccccc2)c2c1C(=O)CCC2 |
| InChI | InChI=1S/C21H19NO2/c1-14-20-17(11-7-12-18(20)23)21(22-14)16-10-5-6-13-19(16)24-15-8-3-2-4-9-15/h2-6,8-10,13,22H,7,11-12H2,1H3 |
| InChIKey | KLYIVVNLQIHWNI-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 42.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.39 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |