C21H20N2O2 — CID 71812048
1-(5-amino-2-phenoxyphenyl)-3-methyl-2,5,6,7-tetrahydroisoindol-4-one (PubChem CID 71812048) has the molecular formula C21H20N2O2 and a molecular weight of 332.40 g/mol. Its IUPAC name is 1-(5-amino-2-phenoxyphenyl)-3-methyl-2,5,6,7-tetrahydroisoindol-4-one.
| Compound Name | 1-(5-amino-2-phenoxyphenyl)-3-methyl-2,5,6,7-tetrahydroisoindol-4-one |
|---|---|
| PubChem CID | 71812048 |
| Molecular Formula | C21H20N2O2 |
| Molecular Weight | 332.40 g/mol |
| Exact Mass | 332.15 |
| IUPAC Name | 1-(5-amino-2-phenoxyphenyl)-3-methyl-2,5,6,7-tetrahydroisoindol-4-one |
| SMILES | Cc1[nH]c(-c2cc(N)ccc2Oc2ccccc2)c2c1C(=O)CCC2 |
| InChI | InChI=1S/C21H20N2O2/c1-13-20-16(8-5-9-18(20)24)21(23-13)17-12-14(22)10-11-19(17)25-15-6-3-2-4-7-15/h2-4,6-7,10-12,23H,5,8-9,22H2,1H3 |
| InChIKey | WEJMCQNBCYFALA-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 68.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.40 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|