C21H18F6N2O3 — CID 71812128
N-[1-[[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]methyl]indol-5-yl]-2-methoxyacetamide (PubChem CID 71812128) has the molecular formula C21H18F6N2O3 and a molecular weight of 460.37 g/mol. Its IUPAC name is N-[1-[[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]methyl]indol-5-yl]-2-methoxyacetamide.
| Compound Name | N-[1-[[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]methyl]indol-5-yl]-2-methoxyacetamide |
|---|---|
| PubChem CID | 71812128 |
| Molecular Formula | C21H18F6N2O3 |
| Molecular Weight | 460.37 g/mol |
| Exact Mass | 460.12 |
| IUPAC Name | N-[1-[[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]methyl]indol-5-yl]-2-methoxyacetamide |
| SMILES | COCC(=O)Nc1ccc2c(ccn2Cc2ccc(C(O)(C(F)(F)F)C(F)(F)F)cc2)c1 |
| InChI | InChI=1S/C21H18F6N2O3/c1-32-12-18(30)28-16-6-7-17-14(10-16)8-9-29(17)11-13-2-4-15(5-3-13)19(31,20(22,23)24)21(25,26)27/h2-10,31H,11-12H2,1H3,(H,28,30) |
| InChIKey | WXXMWRGDCUTNNM-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 63.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.37 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |