C16H27N2O8P — CID 71812371
1-[(2R,3S,4S)-4-[di(propan-2-yloxy)phosphorylmethoxy]-3-hydroxyoxolan-2-yl]-4-methoxypyrimidin-2-one (PubChem CID 71812371) has the molecular formula C16H27N2O8P and a molecular weight of 406.37 g/mol. Its IUPAC name is 1-[(2R,3S,4S)-4-[di(propan-2-yloxy)phosphorylmethoxy]-3-hydroxyoxolan-2-yl]-4-methoxypyrimidin-2-one.
| Compound Name | 1-[(2R,3S,4S)-4-[di(propan-2-yloxy)phosphorylmethoxy]-3-hydroxyoxolan-2-yl]-4-methoxypyrimidin-2-one |
|---|---|
| PubChem CID | 71812371 |
| Molecular Formula | C16H27N2O8P |
| Molecular Weight | 406.37 g/mol |
| Exact Mass | 406.15 |
| IUPAC Name | 1-[(2R,3S,4S)-4-[di(propan-2-yloxy)phosphorylmethoxy]-3-hydroxyoxolan-2-yl]-4-methoxypyrimidin-2-one |
| SMILES | COc1ccn([C@@H]2OC[C@H](OCP(=O)(OC(C)C)OC(C)C)[C@@H]2O)c(=O)n1 |
| InChI | InChI=1S/C16H27N2O8P/c1-10(2)25-27(21,26-11(3)4)9-24-12-8-23-15(14(12)19)18-7-6-13(22-5)17-16(18)20/h6-7,10-12,14-15,19H,8-9H2,1-5H3/t12-,14-,15+/m0/s1 |
| InChIKey | MHZCSZRVDOFWLL-AEGPPILISA-N |
| XLogP | 1.53 |
| TPSA | 118.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.37 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|