C20H42O2Si — CID 71812435
tert-butyl-[(4R,6S,7R)-6-methoxy-7-methyldodec-1-en-4-yl]oxy-dimethylsilane (PubChem CID 71812435) has the molecular formula C20H42O2Si and a molecular weight of 342.64 g/mol. Its IUPAC name is tert-butyl-[(4R,6S,7R)-6-methoxy-7-methyldodec-1-en-4-yl]oxy-dimethylsilane.
| Compound Name | tert-butyl-[(4R,6S,7R)-6-methoxy-7-methyldodec-1-en-4-yl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 71812435 |
| Molecular Formula | C20H42O2Si |
| Molecular Weight | 342.64 g/mol |
| Exact Mass | 342.30 |
| IUPAC Name | tert-butyl-[(4R,6S,7R)-6-methoxy-7-methyldodec-1-en-4-yl]oxy-dimethylsilane |
| SMILES | C=CC[C@H](C[C@H](OC)[C@H](C)CCCCC)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C20H42O2Si/c1-10-12-13-15-17(3)19(21-7)16-18(14-11-2)22-23(8,9)20(4,5)6/h11,17-19H,2,10,12-16H2,1,3-9H3/t17-,18-,19+/m1/s1 |
| InChIKey | DJPZAUSMXHXSKX-QRVBRYPASA-N |
| XLogP | 6.57 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.64 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|