C23H44O4Si — CID 71812438
(2S)-2-[(2R,4S,5R)-2-[tert-butyl(dimethyl)silyl]oxy-4-methoxy-5-methyldecyl]-2,3-dihydropyran-6-one (PubChem CID 71812438) has the molecular formula C23H44O4Si and a molecular weight of 412.69 g/mol. Its IUPAC name is (2S)-2-[(2R,4S,5R)-2-[tert-butyl(dimethyl)silyl]oxy-4-methoxy-5-methyldecyl]-2,3-dihydropyran-6-one.
| Compound Name | (2S)-2-[(2R,4S,5R)-2-[tert-butyl(dimethyl)silyl]oxy-4-methoxy-5-methyldecyl]-2,3-dihydropyran-6-one |
|---|---|
| PubChem CID | 71812438 |
| Molecular Formula | C23H44O4Si |
| Molecular Weight | 412.69 g/mol |
| Exact Mass | 412.30 |
| IUPAC Name | (2S)-2-[(2R,4S,5R)-2-[tert-butyl(dimethyl)silyl]oxy-4-methoxy-5-methyldecyl]-2,3-dihydropyran-6-one |
| SMILES | CCCCC[C@@H](C)[C@H](C[C@@H](C[C@@H]1CC=CC(=O)O1)O[Si](C)(C)C(C)(C)C)OC |
| InChI | InChI=1S/C23H44O4Si/c1-9-10-11-13-18(2)21(25-6)17-20(27-28(7,8)23(3,4)5)16-19-14-12-15-22(24)26-19/h12,15,18-21H,9-11,13-14,16-17H2,1-8H3/t18-,19+,20-,21+/m1/s1 |
| InChIKey | RQGLBSCBFXMNDU-MHTWAQMVSA-N |
| XLogP | 6.26 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.69 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|