About CID 71812475
CID 71812475 (PubChem CID 71812475) has the molecular formula C16H16O3
and a molecular weight of 256.30 g/mol.
Molecular Properties
| Compound Name | CID 71812475 |
| PubChem CID | 71812475 |
| Molecular Formula | C16H16O3 |
| Molecular Weight | 256.30 g/mol |
| Exact Mass | 256.11 |
| IUPAC Name | — |
| SMILES | CC(=O)C1(C)OC([C]2[CH][CH][CH][CH]2)OC1[C]1[CH][CH][CH][CH]1 |
| InChI | InChI=1S/C16H16O3/c1-11(17)16(2)14(12-7-3-4-8-12)18-15(19-16)13-9-5-6-10-13/h3-10,14-15H,1-2H3 |
| InChIKey | DROPTUGWMTXJRT-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.30 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze CID 71812475 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 71812475?
The IUPAC name of CID 71812475 (CID 71812475) is not available.
What is the SMILES notation for CID 71812475?
The canonical SMILES for CID 71812475 is CC(=O)C1(C)OC([C]2[CH][CH][CH][CH]2)OC1[C]1[CH][CH][CH][CH]1.
What is the InChIKey of CID 71812475?
The InChIKey is DROPTUGWMTXJRT-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H16O3/c1-11(17)16(2)14(12-7-3-4-8-12)18-15(19-16)13-9-5-6-10-13/h3-10,14-15H,1-2H3.
What are the key properties of CID 71812475?
CID 71812475 has a molecular weight of 256.30 g/mol, XLogP of 1.89, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 71812475 is sourced from PubChem (CID 71812475), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).