C24H21FN2O4 — CID 7181288
(5R)-5-ethyl-5-(4-fluorophenyl)-3-[(2-oxo-7,8-dihydro-6H-cyclopenta[g]chromen-4-yl)methyl]imidazolidine-2,4-dione (PubChem CID 7181288) has the molecular formula C24H21FN2O4 and a molecular weight of 420.44 g/mol. Its IUPAC name is (5R)-5-ethyl-5-(4-fluorophenyl)-3-[(2-oxo-7,8-dihydro-6H-cyclopenta[g]chromen-4-yl)methyl]imidazolidine-2,4-dione.
| Compound Name | (5R)-5-ethyl-5-(4-fluorophenyl)-3-[(2-oxo-7,8-dihydro-6H-cyclopenta[g]chromen-4-yl)methyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 7181288 |
| Molecular Formula | C24H21FN2O4 |
| Molecular Weight | 420.44 g/mol |
| Exact Mass | 420.15 |
| IUPAC Name | (5R)-5-ethyl-5-(4-fluorophenyl)-3-[(2-oxo-7,8-dihydro-6H-cyclopenta[g]chromen-4-yl)methyl]imidazolidine-2,4-dione |
| SMILES | CC[C@]1(c2ccc(F)cc2)NC(=O)N(Cc2cc(=O)oc3cc4c(cc23)CCC4)C1=O |
| InChI | InChI=1S/C24H21FN2O4/c1-2-24(17-6-8-18(25)9-7-17)22(29)27(23(30)26-24)13-16-12-21(28)31-20-11-15-5-3-4-14(15)10-19(16)20/h6-12H,2-5,13H2,1H3,(H,26,30)/t24-/m1/s1 |
| InChIKey | GTSWVLZKSIHLNS-XMMPIXPASA-N |
| XLogP | 3.78 |
| TPSA | 79.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.44 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|