C20H21N5O5 — CID 71812966
methyl 2-[[4-(3,4,5-trimethoxyanilino)-1,3,5-triazin-2-yl]amino]benzoate (PubChem CID 71812966) has the molecular formula C20H21N5O5 and a molecular weight of 411.42 g/mol. Its IUPAC name is methyl 2-[[4-(3,4,5-trimethoxyanilino)-1,3,5-triazin-2-yl]amino]benzoate.
| Compound Name | methyl 2-[[4-(3,4,5-trimethoxyanilino)-1,3,5-triazin-2-yl]amino]benzoate |
|---|---|
| PubChem CID | 71812966 |
| Molecular Formula | C20H21N5O5 |
| Molecular Weight | 411.42 g/mol |
| Exact Mass | 411.15 |
| IUPAC Name | methyl 2-[[4-(3,4,5-trimethoxyanilino)-1,3,5-triazin-2-yl]amino]benzoate |
| SMILES | COC(=O)c1ccccc1Nc1ncnc(Nc2cc(OC)c(OC)c(OC)c2)n1 |
| InChI | InChI=1S/C20H21N5O5/c1-27-15-9-12(10-16(28-2)17(15)29-3)23-19-21-11-22-20(25-19)24-14-8-6-5-7-13(14)18(26)30-4/h5-11H,1-4H3,(H2,21,22,23,24,25) |
| InChIKey | KAYZTPXHURMMGR-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 116.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.42 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |