C15H21ClO3 — CID 71813296
6-[(3aR,7aS)-2,2-dimethyl-3a,7a-dihydro-1,3-benzodioxol-4-yl]-2-chlorohexan-3-one (PubChem CID 71813296) has the molecular formula C15H21ClO3 and a molecular weight of 284.78 g/mol. Its IUPAC name is 6-[(3aR,7aS)-2,2-dimethyl-3a,7a-dihydro-1,3-benzodioxol-4-yl]-2-chlorohexan-3-one.
| Compound Name | 6-[(3aR,7aS)-2,2-dimethyl-3a,7a-dihydro-1,3-benzodioxol-4-yl]-2-chlorohexan-3-one |
|---|---|
| PubChem CID | 71813296 |
| Molecular Formula | C15H21ClO3 |
| Molecular Weight | 284.78 g/mol |
| Exact Mass | 284.12 |
| IUPAC Name | 6-[(3aR,7aS)-2,2-dimethyl-3a,7a-dihydro-1,3-benzodioxol-4-yl]-2-chlorohexan-3-one |
| SMILES | CC(Cl)C(=O)CCCC1=CC=C[C@@H]2OC(C)(C)O[C@H]12 |
| InChI | InChI=1S/C15H21ClO3/c1-10(16)12(17)8-4-6-11-7-5-9-13-14(11)19-15(2,3)18-13/h5,7,9-10,13-14H,4,6,8H2,1-3H3/t10?,13-,14+/m0/s1 |
| InChIKey | BQBOBNPQLMUSPH-INPHSSGZSA-N |
| XLogP | 3.37 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.78 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|