C15H20O3 — CID 71813450
(1R,2R,6S,9S)-4,4,10-trimethyl-3,5-dioxatetracyclo[7.5.0.01,10.02,6]tetradec-7-en-11-one (PubChem CID 71813450) has the molecular formula C15H20O3 and a molecular weight of 248.32 g/mol. Its IUPAC name is (1R,2R,6S,9S)-4,4,10-trimethyl-3,5-dioxatetracyclo[7.5.0.01,10.02,6]tetradec-7-en-11-one.
| Compound Name | (1R,2R,6S,9S)-4,4,10-trimethyl-3,5-dioxatetracyclo[7.5.0.01,10.02,6]tetradec-7-en-11-one |
|---|---|
| PubChem CID | 71813450 |
| Molecular Formula | C15H20O3 |
| Molecular Weight | 248.32 g/mol |
| Exact Mass | 248.14 |
| IUPAC Name | (1R,2R,6S,9S)-4,4,10-trimethyl-3,5-dioxatetracyclo[7.5.0.01,10.02,6]tetradec-7-en-11-one |
| SMILES | CC1(C)O[C@H]2C=C[C@@H]3C4(C)C(=O)CCC[C@@]34[C@H]2O1 |
| InChI | InChI=1S/C15H20O3/c1-13(2)17-9-6-7-10-14(3)11(16)5-4-8-15(10,14)12(9)18-13/h6-7,9-10,12H,4-5,8H2,1-3H3/t9-,10+,12-,14?,15-/m0/s1 |
| InChIKey | CFMXDISUCZUFIO-OIWMOPNWSA-N |
| XLogP | 2.45 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.32 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|