C30H55N8O2+ — CID 71813515
(2S)-2-[[(2S)-2-amino-3-[1,3-bis(3-cyclohexylpropyl)imidazol-1-ium-4-yl]propanoyl]amino]-5-(diaminomethylideneamino)pentanamide (PubChem CID 71813515) has the molecular formula C30H55N8O2+ and a molecular weight of 559.82 g/mol. Its IUPAC name is (2S)-2-[[(2S)-2-amino-3-[1,3-bis(3-cyclohexylpropyl)imidazol-1-ium-4-yl]propanoyl]amino]-5-(diaminomethylideneamino)pentanamide.
| Compound Name | (2S)-2-[[(2S)-2-amino-3-[1,3-bis(3-cyclohexylpropyl)imidazol-1-ium-4-yl]propanoyl]amino]-5-(diaminomethylideneamino)pentanamide |
|---|---|
| PubChem CID | 71813515 |
| Molecular Formula | C30H55N8O2+ |
| Molecular Weight | 559.82 g/mol |
| Exact Mass | 559.44 |
| IUPAC Name | (2S)-2-[[(2S)-2-amino-3-[1,3-bis(3-cyclohexylpropyl)imidazol-1-ium-4-yl]propanoyl]amino]-5-(diaminomethylideneamino)pentanamide |
| SMILES | NC(=O)[C@H](CCCN=C(N)N)NC(=O)[C@@H](N)Cc1c[n+](CCCC2CCCCC2)cn1CCCC1CCCCC1 |
| InChI | InChI=1S/C30H54N8O2/c31-26(29(40)36-27(28(32)39)16-7-17-35-30(33)34)20-25-21-37(18-8-14-23-10-3-1-4-11-23)22-38(25)19-9-15-24-12-5-2-6-13-24/h21-24,26-27H,1-20,31H2,(H6-,32,33,34,35,36,39,40)/p+1/t26-,27-/m0/s1 |
| InChIKey | NRRADCVFQRUAIW-SVBPBHIXSA-O |
| XLogP | 2.39 |
| TPSA | 171.42 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.82 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|