C24H25Cl3N2O7S — CID 71813936
diethyl 2-(4-methylphenyl)sulfonyl-4-[(2,2,2-trichloroacetyl)amino]-3,4-dihydro-1H-isoquinoline-5,6-dicarboxylate (PubChem CID 71813936) has the molecular formula C24H25Cl3N2O7S and a molecular weight of 591.90 g/mol. Its IUPAC name is diethyl 2-(4-methylphenyl)sulfonyl-4-[(2,2,2-trichloroacetyl)amino]-3,4-dihydro-1H-isoquinoline-5,6-dicarboxylate.
| Compound Name | diethyl 2-(4-methylphenyl)sulfonyl-4-[(2,2,2-trichloroacetyl)amino]-3,4-dihydro-1H-isoquinoline-5,6-dicarboxylate |
|---|---|
| PubChem CID | 71813936 |
| Molecular Formula | C24H25Cl3N2O7S |
| Molecular Weight | 591.90 g/mol |
| Exact Mass | 590.04 |
| IUPAC Name | diethyl 2-(4-methylphenyl)sulfonyl-4-[(2,2,2-trichloroacetyl)amino]-3,4-dihydro-1H-isoquinoline-5,6-dicarboxylate |
| SMILES | CCOC(=O)c1ccc2c(c1C(=O)OCC)C(NC(=O)C(Cl)(Cl)Cl)CN(S(=O)(=O)c1ccc(C)cc1)C2 |
| InChI | InChI=1S/C24H25Cl3N2O7S/c1-4-35-21(30)17-11-8-15-12-29(37(33,34)16-9-6-14(3)7-10-16)13-18(28-23(32)24(25,26)27)19(15)20(17)22(31)36-5-2/h6-11,18H,4-5,12-13H2,1-3H3,(H,28,32) |
| InChIKey | ORERBOINQJJIGR-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 119.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.90 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|