C25H32O6 — CID 71814051
6,8-dihydroxy-2,2,4,4-tetramethyl-7-(3-methylbutanoyl)-9-propan-2-yl-9H-xanthene-1,3-dione (PubChem CID 71814051) has the molecular formula C25H32O6 and a molecular weight of 428.53 g/mol. Its IUPAC name is 6,8-dihydroxy-2,2,4,4-tetramethyl-7-(3-methylbutanoyl)-9-propan-2-yl-9H-xanthene-1,3-dione.
| Compound Name | 6,8-dihydroxy-2,2,4,4-tetramethyl-7-(3-methylbutanoyl)-9-propan-2-yl-9H-xanthene-1,3-dione |
|---|---|
| PubChem CID | 71814051 |
| Molecular Formula | C25H32O6 |
| Molecular Weight | 428.53 g/mol |
| Exact Mass | 428.22 |
| IUPAC Name | 6,8-dihydroxy-2,2,4,4-tetramethyl-7-(3-methylbutanoyl)-9-propan-2-yl-9H-xanthene-1,3-dione |
| SMILES | CC(C)CC(=O)c1c(O)cc2c(c1O)C(C(C)C)C1=C(O2)C(C)(C)C(=O)C(C)(C)C1=O |
| InChI | InChI=1S/C25H32O6/c1-11(2)9-13(26)17-14(27)10-15-18(20(17)28)16(12(3)4)19-21(29)24(5,6)23(30)25(7,8)22(19)31-15/h10-12,16,27-28H,9H2,1-8H3 |
| InChIKey | XJNGWIWWMVHPRG-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 100.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.53 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|