C9H7N3O3 — CID 71814481
1-(furan-2-yl)-3-(1H-1,2,4-triazol-5-yl)propane-1,3-dione (PubChem CID 71814481) has the molecular formula C9H7N3O3 and a molecular weight of 205.17 g/mol. Its IUPAC name is 1-(furan-2-yl)-3-(1H-1,2,4-triazol-5-yl)propane-1,3-dione.
| Compound Name | 1-(furan-2-yl)-3-(1H-1,2,4-triazol-5-yl)propane-1,3-dione |
|---|---|
| PubChem CID | 71814481 |
| Molecular Formula | C9H7N3O3 |
| Molecular Weight | 205.17 g/mol |
| Exact Mass | 205.05 |
| IUPAC Name | 1-(furan-2-yl)-3-(1H-1,2,4-triazol-5-yl)propane-1,3-dione |
| SMILES | O=C(CC(=O)c1ccco1)c1ncn[nH]1 |
| InChI | InChI=1S/C9H7N3O3/c13-6(8-2-1-3-15-8)4-7(14)9-10-5-11-12-9/h1-3,5H,4H2,(H,10,11,12) |
| InChIKey | OJZZFNYECZVEJQ-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 88.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.17 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|