C13H17N3O2 — CID 71814542
CID 71814542 (PubChem CID 71814542) has the molecular formula C13H17N3O2 and a molecular weight of 247.30 g/mol.
| Compound Name | CID 71814542 |
|---|---|
| PubChem CID | 71814542 |
| Molecular Formula | C13H17N3O2 |
| Molecular Weight | 247.30 g/mol |
| Exact Mass | 247.13 |
| IUPAC Name | — |
| SMILES | COCCNC(=O)CN1[C]N(C)c2ccccc21 |
| InChI | InChI=1S/C13H17N3O2/c1-15-10-16(9-13(17)14-7-8-18-2)12-6-4-3-5-11(12)15/h3-6H,7-9H2,1-2H3,(H,14,17) |
| InChIKey | VKXSQBKRWWKNKZ-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.30 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|