C23H26FN3O6S — CID 71814688
(5S)-5-[[4-[4-[(3-fluorophenyl)methoxy]phenoxy]piperidin-1-yl]sulfonylmethyl]-5-methylimidazolidine-2,4-dione (PubChem CID 71814688) has the molecular formula C23H26FN3O6S and a molecular weight of 491.54 g/mol. Its IUPAC name is (5S)-5-[[4-[4-[(3-fluorophenyl)methoxy]phenoxy]piperidin-1-yl]sulfonylmethyl]-5-methylimidazolidine-2,4-dione.
| Compound Name | (5S)-5-[[4-[4-[(3-fluorophenyl)methoxy]phenoxy]piperidin-1-yl]sulfonylmethyl]-5-methylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 71814688 |
| Molecular Formula | C23H26FN3O6S |
| Molecular Weight | 491.54 g/mol |
| Exact Mass | 491.15 |
| IUPAC Name | (5S)-5-[[4-[4-[(3-fluorophenyl)methoxy]phenoxy]piperidin-1-yl]sulfonylmethyl]-5-methylimidazolidine-2,4-dione |
| SMILES | C[C@]1(CS(=O)(=O)N2CCC(Oc3ccc(OCc4cccc(F)c4)cc3)CC2)NC(=O)NC1=O |
| InChI | InChI=1S/C23H26FN3O6S/c1-23(21(28)25-22(29)26-23)15-34(30,31)27-11-9-20(10-12-27)33-19-7-5-18(6-8-19)32-14-16-3-2-4-17(24)13-16/h2-8,13,20H,9-12,14-15H2,1H3,(H2,25,26,28,29)/t23-/m1/s1 |
| InChIKey | BIHFFXMAAJBXAB-HSZRJFAPSA-N |
| XLogP | 2.18 |
| TPSA | 114.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.54 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|