C21H28O2 — CID 71814752
1-[(4bR,6aS,8S,10aS,10bS)-8-hydroxy-10a-methyl-5,6,6a,7,8,9,10,10b,11,12-decahydro-4bH-chrysen-2-yl]ethanone (PubChem CID 71814752) has the molecular formula C21H28O2 and a molecular weight of 312.45 g/mol. Its IUPAC name is 1-[(4bR,6aS,8S,10aS,10bS)-8-hydroxy-10a-methyl-5,6,6a,7,8,9,10,10b,11,12-decahydro-4bH-chrysen-2-yl]ethanone.
| Compound Name | 1-[(4bR,6aS,8S,10aS,10bS)-8-hydroxy-10a-methyl-5,6,6a,7,8,9,10,10b,11,12-decahydro-4bH-chrysen-2-yl]ethanone |
|---|---|
| PubChem CID | 71814752 |
| Molecular Formula | C21H28O2 |
| Molecular Weight | 312.45 g/mol |
| Exact Mass | 312.21 |
| IUPAC Name | 1-[(4bR,6aS,8S,10aS,10bS)-8-hydroxy-10a-methyl-5,6,6a,7,8,9,10,10b,11,12-decahydro-4bH-chrysen-2-yl]ethanone |
| SMILES | CC(=O)c1ccc2c(c1)CC[C@H]1[C@H]2CC[C@H]2C[C@@H](O)CC[C@@]21C |
| InChI | InChI=1S/C21H28O2/c1-13(22)14-3-6-18-15(11-14)4-8-20-19(18)7-5-16-12-17(23)9-10-21(16,20)2/h3,6,11,16-17,19-20,23H,4-5,7-10,12H2,1-2H3/t16-,17-,19-,20-,21-/m0/s1 |
| InChIKey | PRNHINLCNXLFDS-XYYCENQHSA-N |
| XLogP | 4.50 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.45 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |