C22H26N4O6S — CID 71814859
(5S)-5-methyl-5-[[4-[4-(pyridin-2-ylmethoxy)phenoxy]piperidin-1-yl]sulfonylmethyl]imidazolidine-2,4-dione (PubChem CID 71814859) has the molecular formula C22H26N4O6S and a molecular weight of 474.54 g/mol. Its IUPAC name is (5S)-5-methyl-5-[[4-[4-(pyridin-2-ylmethoxy)phenoxy]piperidin-1-yl]sulfonylmethyl]imidazolidine-2,4-dione.
| Compound Name | (5S)-5-methyl-5-[[4-[4-(pyridin-2-ylmethoxy)phenoxy]piperidin-1-yl]sulfonylmethyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 71814859 |
| Molecular Formula | C22H26N4O6S |
| Molecular Weight | 474.54 g/mol |
| Exact Mass | 474.16 |
| IUPAC Name | (5S)-5-methyl-5-[[4-[4-(pyridin-2-ylmethoxy)phenoxy]piperidin-1-yl]sulfonylmethyl]imidazolidine-2,4-dione |
| SMILES | C[C@]1(CS(=O)(=O)N2CCC(Oc3ccc(OCc4ccccn4)cc3)CC2)NC(=O)NC1=O |
| InChI | InChI=1S/C22H26N4O6S/c1-22(20(27)24-21(28)25-22)15-33(29,30)26-12-9-19(10-13-26)32-18-7-5-17(6-8-18)31-14-16-4-2-3-11-23-16/h2-8,11,19H,9-10,12-15H2,1H3,(H2,24,25,27,28)/t22-/m1/s1 |
| InChIKey | JHHVLAYNAWPINK-JOCHJYFZSA-N |
| XLogP | 1.43 |
| TPSA | 126.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.54 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|