C14H16N2O2 — CID 71815052
(3aR,9bS)-2-ethyl-8-methyl-3a,4,5,9b-tetrahydropyrrolo[3,4-c]quinoline-1,3-dione (PubChem CID 71815052) has the molecular formula C14H16N2O2 and a molecular weight of 244.29 g/mol. Its IUPAC name is (3aR,9bS)-2-ethyl-8-methyl-3a,4,5,9b-tetrahydropyrrolo[3,4-c]quinoline-1,3-dione.
| Compound Name | (3aR,9bS)-2-ethyl-8-methyl-3a,4,5,9b-tetrahydropyrrolo[3,4-c]quinoline-1,3-dione |
|---|---|
| PubChem CID | 71815052 |
| Molecular Formula | C14H16N2O2 |
| Molecular Weight | 244.29 g/mol |
| Exact Mass | 244.12 |
| IUPAC Name | (3aR,9bS)-2-ethyl-8-methyl-3a,4,5,9b-tetrahydropyrrolo[3,4-c]quinoline-1,3-dione |
| SMILES | CCN1C(=O)[C@H]2CNc3ccc(C)cc3[C@H]2C1=O |
| InChI | InChI=1S/C14H16N2O2/c1-3-16-13(17)10-7-15-11-5-4-8(2)6-9(11)12(10)14(16)18/h4-6,10,12,15H,3,7H2,1-2H3/t10-,12+/m0/s1 |
| InChIKey | BIRQXUVAEBFLMJ-CMPLNLGQSA-N |
| XLogP | 1.51 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.29 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|