C18H21FN2O4 — CID 7181524
(5S,6S)-3-[2-(5-fluoro-2-methoxyphenyl)-2-oxoethyl]-6-methyl-1,3-diazaspiro[4.5]decane-2,4-dione (PubChem CID 7181524) has the molecular formula C18H21FN2O4 and a molecular weight of 348.37 g/mol. Its IUPAC name is (5S,6S)-3-[2-(5-fluoro-2-methoxyphenyl)-2-oxoethyl]-6-methyl-1,3-diazaspiro[4.5]decane-2,4-dione.
| Compound Name | (5S,6S)-3-[2-(5-fluoro-2-methoxyphenyl)-2-oxoethyl]-6-methyl-1,3-diazaspiro[4.5]decane-2,4-dione |
|---|---|
| PubChem CID | 7181524 |
| Molecular Formula | C18H21FN2O4 |
| Molecular Weight | 348.37 g/mol |
| Exact Mass | 348.15 |
| IUPAC Name | (5S,6S)-3-[2-(5-fluoro-2-methoxyphenyl)-2-oxoethyl]-6-methyl-1,3-diazaspiro[4.5]decane-2,4-dione |
| SMILES | COc1ccc(F)cc1C(=O)CN1C(=O)N[C@]2(CCCC[C@@H]2C)C1=O |
| InChI | InChI=1S/C18H21FN2O4/c1-11-5-3-4-8-18(11)16(23)21(17(24)20-18)10-14(22)13-9-12(19)6-7-15(13)25-2/h6-7,9,11H,3-5,8,10H2,1-2H3,(H,20,24)/t11-,18-/m0/s1 |
| InChIKey | PGMGMGQSGDWZRB-VOJFVSQTSA-N |
| XLogP | 2.52 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.37 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|