C24H24N6S — CID 71815379
5-[5-[4-(4-methylpiperazin-1-yl)phenyl]-9-thia-3,4-diazatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,10-tetraen-10-yl]pyridin-2-amine (PubChem CID 71815379) has the molecular formula C24H24N6S and a molecular weight of 428.57 g/mol. Its IUPAC name is 5-[5-[4-(4-methylpiperazin-1-yl)phenyl]-9-thia-3,4-diazatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,10-tetraen-10-yl]pyridin-2-amine.
| Compound Name | 5-[5-[4-(4-methylpiperazin-1-yl)phenyl]-9-thia-3,4-diazatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,10-tetraen-10-yl]pyridin-2-amine |
|---|---|
| PubChem CID | 71815379 |
| Molecular Formula | C24H24N6S |
| Molecular Weight | 428.57 g/mol |
| Exact Mass | 428.18 |
| IUPAC Name | 5-[5-[4-(4-methylpiperazin-1-yl)phenyl]-9-thia-3,4-diazatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,10-tetraen-10-yl]pyridin-2-amine |
| SMILES | CN1CCN(c2ccc(-c3n[nH]c4c3Cc3sc(-c5ccc(N)nc5)cc3-4)cc2)CC1 |
| InChI | InChI=1S/C24H24N6S/c1-29-8-10-30(11-9-29)17-5-2-15(3-6-17)23-19-13-21-18(24(19)28-27-23)12-20(31-21)16-4-7-22(25)26-14-16/h2-7,12,14H,8-11,13H2,1H3,(H2,25,26)(H,27,28) |
| InChIKey | FNRKDZLFTYPIDO-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 74.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.57 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |