C19H16ClFN4O3 — CID 71815402
N-[(3-chloro-5-fluorophenyl)methyl]-3-hydroxy-2-oxo-1-(1H-pyrrolo[2,3-b]pyridin-5-yl)pyrrolidine-3-carboxamide (PubChem CID 71815402) has the molecular formula C19H16ClFN4O3 and a molecular weight of 402.81 g/mol. Its IUPAC name is N-[(3-chloro-5-fluorophenyl)methyl]-3-hydroxy-2-oxo-1-(1H-pyrrolo[2,3-b]pyridin-5-yl)pyrrolidine-3-carboxamide.
| Compound Name | N-[(3-chloro-5-fluorophenyl)methyl]-3-hydroxy-2-oxo-1-(1H-pyrrolo[2,3-b]pyridin-5-yl)pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 71815402 |
| Molecular Formula | C19H16ClFN4O3 |
| Molecular Weight | 402.81 g/mol |
| Exact Mass | 402.09 |
| IUPAC Name | N-[(3-chloro-5-fluorophenyl)methyl]-3-hydroxy-2-oxo-1-(1H-pyrrolo[2,3-b]pyridin-5-yl)pyrrolidine-3-carboxamide |
| SMILES | O=C(NCc1cc(F)cc(Cl)c1)C1(O)CCN(c2cnc3[nH]ccc3c2)C1=O |
| InChI | InChI=1S/C19H16ClFN4O3/c20-13-5-11(6-14(21)8-13)9-24-17(26)19(28)2-4-25(18(19)27)15-7-12-1-3-22-16(12)23-10-15/h1,3,5-8,10,28H,2,4,9H2,(H,22,23)(H,24,26) |
| InChIKey | FCQXUOXAHALHCG-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 98.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.81 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|