C14H9Cl2N3S — CID 71815573
N-(3,4-dichlorophenyl)-9-thia-3,4-diazatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,10-tetraen-5-amine (PubChem CID 71815573) has the molecular formula C14H9Cl2N3S and a molecular weight of 322.22 g/mol. Its IUPAC name is N-(3,4-dichlorophenyl)-9-thia-3,4-diazatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,10-tetraen-5-amine.
| Compound Name | N-(3,4-dichlorophenyl)-9-thia-3,4-diazatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,10-tetraen-5-amine |
|---|---|
| PubChem CID | 71815573 |
| Molecular Formula | C14H9Cl2N3S |
| Molecular Weight | 322.22 g/mol |
| Exact Mass | 320.99 |
| IUPAC Name | N-(3,4-dichlorophenyl)-9-thia-3,4-diazatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,10-tetraen-5-amine |
| SMILES | Clc1ccc(Nc2n[nH]c3c2Cc2sccc2-3)cc1Cl |
| InChI | InChI=1S/C14H9Cl2N3S/c15-10-2-1-7(5-11(10)16)17-14-9-6-12-8(3-4-20-12)13(9)18-19-14/h1-5H,6H2,(H2,17,18,19) |
| InChIKey | QXPISWTWGLBWCA-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.22 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |