About N-[(2E)-3,7-dimethylocta-2,6-dienyl]-2-ethoxyacetamide
N-[(2E)-3,7-dimethylocta-2,6-dienyl]-2-ethoxyacetamide (PubChem CID 71815916) has the molecular formula C14H25NO2
and a molecular weight of 239.36 g/mol. Its IUPAC name is N-[(2E)-3,7-dimethylocta-2,6-dienyl]-2-ethoxyacetamide.
Molecular Properties
| Compound Name | N-[(2E)-3,7-dimethylocta-2,6-dienyl]-2-ethoxyacetamide |
| PubChem CID | 71815916 |
| Molecular Formula | C14H25NO2 |
| Molecular Weight | 239.36 g/mol |
| Exact Mass | 239.19 |
| IUPAC Name | N-[(2E)-3,7-dimethylocta-2,6-dienyl]-2-ethoxyacetamide |
| SMILES | CCOCC(=O)NC/C=C(\C)CCC=C(C)C |
| InChI | InChI=1S/C14H25NO2/c1-5-17-11-14(16)15-10-9-13(4)8-6-7-12(2)3/h7,9H,5-6,8,10-11H2,1-4H3,(H,15,16)/b13-9+ |
| InChIKey | RVJUFWDQMJJJLZ-UKTHLTGXSA-N |
| XLogP | 2.83 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.36 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N-[(2E)-3,7-dimethylocta-2,6-dienyl]-2-ethoxyacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(2E)-3,7-dimethylocta-2,6-dienyl]-2-ethoxyacetamide?
The IUPAC name of N-[(2E)-3,7-dimethylocta-2,6-dienyl]-2-ethoxyacetamide (CID 71815916) is N-[(2E)-3,7-dimethylocta-2,6-dienyl]-2-ethoxyacetamide.
What is the SMILES notation for N-[(2E)-3,7-dimethylocta-2,6-dienyl]-2-ethoxyacetamide?
The canonical SMILES for N-[(2E)-3,7-dimethylocta-2,6-dienyl]-2-ethoxyacetamide is CCOCC(=O)NC/C=C(\C)CCC=C(C)C.
What is the InChIKey of N-[(2E)-3,7-dimethylocta-2,6-dienyl]-2-ethoxyacetamide?
The InChIKey is RVJUFWDQMJJJLZ-UKTHLTGXSA-N. The full InChI is InChI=1S/C14H25NO2/c1-5-17-11-14(16)15-10-9-13(4)8-6-7-12(2)3/h7,9H,5-6,8,10-11H2,1-4H3,(H,15,16)/b13-9+.
What are the key properties of N-[(2E)-3,7-dimethylocta-2,6-dienyl]-2-ethoxyacetamide?
N-[(2E)-3,7-dimethylocta-2,6-dienyl]-2-ethoxyacetamide has a molecular weight of 239.36 g/mol, XLogP of 2.83, 8 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(2E)-3,7-dimethylocta-2,6-dienyl]-2-ethoxyacetamide is sourced from PubChem (CID 71815916), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).